Organofluorine chemistry:
science, technologies, manufacture since 1987
5-Fluorosulfonylperfluoro(2-methyl-3-oxapentanoyl) fluoride
OBDepict S O F F F F F F F F F O O F O
Price: 500g - 894 EURO
In Stock: 4.9 kg
Capacity per Month: 50 kg

Catalog Number: 1467

CAS: 4089-57-0

MDL number: MFCD16620593

Purity: 97%

Molecular Formula: C5F10O4S

Molecular Weight: 346.1

Physical properties

Boiling Point, °C: 87-89

Refractive Index, n20
1,2912, t=21

Density, g/cm³: 1,6

Additional information


Moisture Sensitive

SMILES: FC(=O)C(C(F)(F)F)(OC(C(S(=O)(=O)F)(F)F)(F)F)F
