Organofluorine chemistry:
science, technologies, manufacture since 1987
Tris(pentafluorophenyl)phosphine
OBDepict F P F F F F F F F F F F F F F F
Price: 100g - 899 EURO

Catalog Number: 1114

CAS: 1259-35-4

MDL number: MFCD00079654

Purity: 97%

Molecular Formula: C18F15P

Molecular Weight: 532.15

Physical properties

Melting Point, °C: 115-116

Additional information

Irritant

SMILES: Fc1c(P(c2c(F)c(F)c(c(c2F)F)F)c2c(F)c(F)c(c(c2F)F)F)c(F)c(c(c1F)F)F

Order