Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict F F F F F F F F F Br F F F F F F T
Price: 0 EURO
In Stock: 25 g

Catalog Number: 0121

CAS: 128454-94-4

MDL number: MFCD09998034

Purity: 97%

Molecular Formula: C8H2BrF13

Molecular Weight: 424.99

Physical properties

Boiling Point, °C: 110

Additional information


SMILES: Br/C=C/C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F
