Organofluorine chemistry:
science, technologies, manufacture since 1987
8-Fluorosulfonylperfluoro(2,5-dimethyl-3,6-dioxaoctanoyl) fluoride
OBDepict S O O F F F F F F F F F F F O F O F F F F O
Price: 1kg - 1240 EURO
In Stock: 9.9 kg

Catalog Number: 1466

CAS: 4089-58-1

MDL number: MFCD16621332

Purity: 97%

Molecular Formula: C8F16O5S

Molecular Weight: 512.12

Physical properties

Boiling Point, °C: 142-145

Additional information

SMILES: FC(=O)C(C(F)(F)F)(OC(C(C(F)(F)F)(OC(C(S(=O)(=O)F)(F)F)(F)F)F)(F)F)F
