Organofluorine chemistry:
science, technologies, manufacture since 1987
Molybdenum(VI) dioxide bis(1,1,1,5,5,5-hexafluoroacetylacetonate)
OBDepict O _ O O _ O 2+ Mo F F F F F F F F F F F F O O T T
Price: 100g - 776 EURO

Catalog Number: 1515

CAS: 155662-73-0

MDL number: MFCD27918546

Purity: 97%

Molecular Formula: C10H2F12MoO6

Molecular Weight: 542.04

Physical properties
Additional information

Irritant

SMILES: O=C(C(F)(F)F)/C=C(/C(F)(F)F)\[O-][Mo+2](=O)(=O)[O-]/C(=C\C(=O)C(F)(F)F)/C(F)(F)F

Order