Organofluorine chemistry:
science, technologies, manufacture since 1987
1H,1H-Perfluorooctylamine (tech.)
OBDepict F NH 2 F F F F F F F F F F F F F F
Price: 100g - 826 EURO
In Stock: 80 g

Catalog Number: 1529

CAS: 307-29-9

MDL number: MFCD00042460

Purity: 85%

Molecular Formula: C8H4F15N

Molecular Weight: 399.1

Physical properties

Boiling Point, °C: 150-152

Refractive Index, n20

Density, g/cm³: 1,714

Additional information



SMILES: FC(CN)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F
