Organofluorine chemistry:
science, technologies, manufacture since 1987
Copper(II) hexafluoroacetylacetonate
OBDepict O _ O O _ O F F F F F F F F F F F F 2+ Cu T T
Price: 250g - 701 EURO
In Stock: 110 g
Synonyms:
Copper(II) 1,1,1,5,5,5-hexafluoroacetylacetonate

Catalog Number: 1553

CAS: 14781-45-4

MDL number: MFCD00151019

Purity: 97%

Molecular Formula: C10H2CuF12O4

Molecular Weight: 477.65

Physical properties

Melting Point, °C: 97-99

Additional information

Irritant

SMILES: C(F)(F)(F)C(=O)/C=C(\[O-][Cu+2][O-]/C(/C(F)(F)F)=C\C(=O)C(F)(F)F)/C(F)(F)F

Order