Organofluorine chemistry:
science, technologies, manufacture since 1987
Perfluorotetradecane
OBDepict F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F
In Stock: 70 g
Capacity per Month: 25 kg

Catalog Number: 1638

CAS: 307-62-0

MDL number: MFCD00013571

Purity: 97%

Molecular Formula: C14F30

Molecular Weight: 738.11

Physical properties

Melting Point, °C: 78-80

Boiling Point, °C: 98-99/13 mm Hg

Additional information

Irritant

SMILES: FC(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Order