Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict I F F F F F F F F F F F F F F F
In Stock: 240 g
Capacity per Month: 50 kg

Catalog Number: 1742

CAS: 335-58-0

MDL number: MFCD00013712

Purity: 96%

Molecular Formula: C7F15I

Molecular Weight: 495.95

Physical properties

Melting Point, °C: -8

Boiling Point, °C: 137-138

Refractive Index, n20

Flash Point, °C: none

Density, g/cm³: 2,01

Additional information


SMILES: IC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
