Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict Br O O F F F F F F F F F F F F F F F
Price: 1kg - 1350 EURO

Catalog Number: 1872

CAS: 1482416-44-3

MDL number: MFCD27918479

Purity: 97%

Molecular Formula: C7BrF15O2

Molecular Weight: 480.95

Physical properties

Boiling Point, °C: 108-110

Additional information

SMILES: BrC(C(OC(C(OC(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(F)F
