Organofluorine chemistry:
science, technologies, manufacture since 1987
2,6-Bis(trifluoromethyl)-4H-pyran-4-one
OBDepict F O O F F F F F
In Stock: 680 g

Catalog Number: 1899

CAS: 847947-33-5

MDL number: MFCD08447318

Purity: 98%

Molecular Formula: C7H2F6O2

Molecular Weight: 232.08

Physical properties

Boiling Point, °C: 139-140

Additional information

SMILES: FC(C=1OC(=CC(C1)=O)C(F)(F)F)(F)F

Order