Organofluorine chemistry:
science, technologies, manufacture since 1987
2-(Pentafluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane
OBDepict F F F F O O F F F F
In Stock: 250 g

Catalog Number: 2043

CAS: 122814-62-4

Purity: 98%

Molecular Formula: C6H4F8O2

Molecular Weight: 260.08

Physical properties

Boiling Point, °C: 120-128

Additional information

SMILES: FC(C(F)(F)F)(C1(OCCO1)C(F)(F)F)F

Order