Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict F F F F F F F F F F F F Cl F F F F
Price: 100g - 806 EURO
In Stock: 140 g

Catalog Number: 0238

CAS: 423-53-0

MDL number: MFCD00155674

Purity: 97%

Molecular Formula: C8HClF16

Molecular Weight: 436.52

Physical properties

Boiling Point, °C: 144-145

Refractive Index, n20

Density, g/cm³: 1,778

Additional information


SMILES: FC(C(C(C(C(C(C(C(Cl)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F
