Organofluorine chemistry:
science, technologies, manufacture since 1987
Decafluorobiphenyl
OBDepict F F F F F F F F F F
Capacity per Month: 200 kg

Catalog Number: 0272

CAS: 434-90-2

MDL number: MFCD00000292

Purity: 99%

Molecular Formula: C12F10

Molecular Weight: 334.12

Physical properties

Melting Point, °C: 68-69

Boiling Point, °C: 206

Density, g/cm³: 1,785

Additional information

Irritant

SMILES: Fc1c(c2c(F)c(F)c(c(c2F)F)F)c(F)c(c(c1F)F)F

Order