Organofluorine chemistry:
science, technologies, manufacture since 1987
Heptafluorobutyric anhydride
OBDepict O O O F F F F F F F F F F F F F F
In Stock: 44.24 kg
Capacity per Month: 600 kg

Catalog Number: 0427

CAS: 336-59-4

MDL number: MFCD00000432

Purity: 99%

Molecular Formula: C8F14O3

Molecular Weight: 410.06

Physical properties

Melting Point, °C: -43

Boiling Point, °C: 108-109

Refractive Index, n20
D
:
1,2850-1,2870

Flash Point, °C: none

Density, g/cm³: 1,665

Additional information

Corrosive

Harmful

Hygroscopic

SMILES: O=C(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)C(C(C(F)(F)F)(F)F)(F)F

Order