Organofluorine chemistry:
science, technologies, manufacture since 1987
Ammonium pentafluoropropionate
OBDepict O _ O F F F F F + N H H H H
Price: 250g - 780 EURO

Catalog Number: 0048

CAS: 2730-58-7

MDL number: MFCD17676088

Purity: 97%

Molecular Formula: C3H4F5NO2

Molecular Weight: 181.06

Physical properties
Additional information

Harmful

SMILES: [O-]C(=O)C(C(F)(F)F)(F)F.[NH4+]

Order