Organofluorine chemistry:
science, technologies, manufacture since 1987
Hexafluoropropene trimer (mixture of isomers)
OBDepict F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F F
In Stock: 36.8 kg
Capacity per Month: 300 kg
Synonyms:
Perfluoropropene trimer (mixture of isomers)

Catalog Number: 0498

CAS: 6792-31-0

MDL number: MFCD00043821

Purity: 97% min

Molecular Formula: C9F18

Molecular Weight: 450.07

Physical properties

Boiling Point, °C: 110-115

Refractive Index, n20
D
:
none

Flash Point, °C: none

Density, g/cm³: 1,83

Additional information

Irritant

SMILES: FC(C(=C(C(C(F)(F)F)(C(F)(F)F)F)C(C(F)(F)F)(F)F)C(F)(F)F)(F)F.FC(=C(C(C(F)(F)F)(C(F)(F)F)F)C(C(F)(F)F)(C(F)(F)F)F)C(F)(F)F

Order