Organofluorine chemistry:
science, technologies, manufacture since 1987
Ammonium perfluoro(2-methyl-3-oxahexanoate)
OBDepict O _ O O F F F F F F F F F F F + N H H H H
Price: 100g - 695 EURO
In Stock: 45.345 kg
Ammonium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionate
Ammonium 2-(heptafluoropropoxy)tetrafluoropropionate

Catalog Number: 0050

CAS: 62037-80-3

MDL number: MFCD17676087

Purity: 97%

Molecular Formula: C6H4F11NO3

Molecular Weight: 347.08

Physical properties

Melting Point, °C: 190-192

Additional information


SMILES: [O-]C(=O)C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F.[NH4+]
