Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict HO F F F HO F F F F F F F F F
Price: 1kg - 1322 EURO
In Stock: 21.6 kg
Capacity per Month: 50 kg

Catalog Number: 0064

CAS: 802-93-7

MDL number: MFCD00042090

Purity: 97%

Molecular Formula: C12H6F12O2

Molecular Weight: 410.16

Physical properties

Melting Point, °C: 9-10

Boiling Point, °C: 205-208

Refractive Index, n20

Flash Point, °C: 97

Density, g/cm³: 1,659

Additional information



SMILES: OC(C(F)(F)F)(C(F)(F)F)c1cccc(c1)C(C(F)(F)F)(C(F)(F)F)O
