Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict F O O F F F F F O F F F F
In Stock: 310 g
Capacity per Month: 30 kg
Dipentafluorophenyl carbonate

Catalog Number: 0067

CAS: 59483-84-0

MDL number: MFCD00368353

Purity: 97%min

Molecular Formula: C13F10O3

Molecular Weight: 394.13

Physical properties

Melting Point, °C: 49-50

Boiling Point, °C: 250

Flash Point, °C: 110

Additional information


SMILES: O=C(Oc1c(F)c(F)c(c(c1F)F)F)Oc1c(F)c(F)c(c(c1F)F)F
