Organofluorine chemistry:
science, technologies, manufacture since 1987
Bis(1H,1H,7H-perfluoroheptyloxy)methane
OBDepict O O F F F F F F F F F F F F F F F F F F F F F F F F
Price: 100g - 667 EURO
Synonyms:
Bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyloxy)methane

Catalog Number: 0073

CAS: 116146-19-1

MDL number: MFCD00155919

Purity: 97%

Molecular Formula: C15H8F24O2

Molecular Weight: 676.19

Physical properties
Additional information

SMILES: FC(C(C(C(C(C(COCOCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F

Order