Organofluorine chemistry:
science, technologies, manufacture since 1987
cis/trans-Perfluorodecalin
OBDepict F F F F F F F F F F F F F F F F F F
In Stock: 2.46 kg
Capacity per Month: 200 kg
Synonyms:
Octadecafluorodecahydronaphthalene

Catalog Number: 0763

CAS: 306-94-5

MDL number: MFCD00010626

Purity: 99%

Molecular Formula: C10F18

Molecular Weight: 462.08

Physical properties

Melting Point, °C: 2-4

Boiling Point, °C: 141-142

Refractive Index, n20
D
:
1,3135-1,3155

Flash Point, °C: none

Density, g/cm³: 1,906

Additional information

Irritant

SMILES: FC12C(F)(C(F)(F)C(C(C2(F)F)(F)F)(F)F)C(F)(F)C(C(C1(F)F)(F)F)(F)F

Order