Organofluorine chemistry:
science, technologies, manufacture since 1987
1,4-Bis(heptafluoroisopropyl)benzene
OBDepict F F F F F F F F F F F F F F
Price: 25g - 580 EURO
Synonyms:
1,4-Bis(perfluoroisopropyl)benzene

Catalog Number: 0078

CAS: 51114-12-6

MDL number: MFCD00041486

Purity: 97%

Molecular Formula: C12H4F14

Molecular Weight: 414.14

Physical properties

Melting Point, °C: 63-64

Additional information

Irritant

SMILES: FC(C(F)(F)F)(C(F)(F)F)c1ccc(cc1)C(C(F)(F)F)(C(F)(F)F)F

Order