Organofluorine chemistry:
science, technologies, manufacture since 1987
OBDepict F F F F F F F F F F F F T
In Stock: 477 g
Capacity per Month: 3000 kg

Catalog Number: 0828

CAS: 2070-70-4

MDL number: MFCD00153253

Purity: 95%

Molecular Formula: C6F12

Molecular Weight: 300.05

Physical properties

Boiling Point, °C: 49-50

Refractive Index, n20

Density, g/cm³: 1,58

Additional information


SMILES: F/C(=C(\C(C(F)(F)F)(C(F)(F)F)F)/F)/C(F)(F)F
