Organofluorine chemistry:
science, technologies, manufacture since 1987
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenylacetic acid
OBDepict F F F F O OH F F F
In Stock: 6.7 kg
Capacity per Month: 200 kg
(4-Perfluorotolyl)acetic acid

Catalog Number: 0885

CAS: 32304-29-3

MDL number: MFCD00559327

Purity: 97%

Molecular Formula: C9H3F7O2

Molecular Weight: 276.11

Physical properties

Melting Point, °C: 77-80

Additional information


SMILES: OC(=O)Cc1c(F)c(F)c(c(c1F)F)C(F)(F)F
