Organofluorine chemistry:
science, technologies, manufacture since 1987
1H,1H,11H-Perfluoroundecan-1-ol
OBDepict F F F F F F F F F F F F F F F F F F F F OH
In Stock: 518.34 kg
Capacity per Month: 200 kg
Synonyms:
1H,1H,11H-Eicosafluoro-1-undecanol

Catalog Number: 0891

CAS: 307-70-0

MDL number: MFCD00039628

Purity: 94-95%

Molecular Formula: C11H4F20O

Molecular Weight: 532.12

Physical properties

Melting Point, °C: 95-97

Boiling Point, °C: 180-181/200 mm Hg

Additional information

Irritant

SMILES: OCC(C(C(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Order